C20H18ClNO5 — CID 167507097
methyl 4-chloro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylate (PubChem CID 167507097) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is methyl 4-chloro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylate.
| Compound Name | methyl 4-chloro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylate |
|---|---|
| PubChem CID | 167507097 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 4-chloro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylate |
| SMILES | COC(=O)C1(CC=O)c2cccc(Cl)c2C(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18ClNO5/c1-26-14-8-6-13(7-9-14)12-22-18(24)17-15(4-3-5-16(17)21)20(22,10-11-23)19(25)27-2/h3-9,11H,10,12H2,1-2H3 |
| InChIKey | LHSKCQJNRFQTLG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|