C21H19BrFNO4 — CID 175867995
methyl (1R)-7-bromo-5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate (PubChem CID 175867995) has the molecular formula C21H19BrFNO4 and a molecular weight of 448.29 g/mol. Its IUPAC name is methyl (1R)-7-bromo-5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate.
| Compound Name | methyl (1R)-7-bromo-5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate |
|---|---|
| PubChem CID | 175867995 |
| Molecular Formula | C21H19BrFNO4 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | methyl (1R)-7-bromo-5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)c2c(Br)cc(F)cc2C(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H19BrFNO4/c1-4-9-21(20(26)28-3)18-16(10-14(23)11-17(18)22)19(25)24(21)12-13-5-7-15(27-2)8-6-13/h4-8,10-11H,1,9,12H2,2-3H3/t21-/m1/s1 |
| InChIKey | IFPMTWHYIIQOJN-OAQYLSRUSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|