C17H16BrNO3 — CID 150666974
3-bromo-7-methoxy-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one (PubChem CID 150666974) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is 3-bromo-7-methoxy-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 3-bromo-7-methoxy-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 150666974 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 3-bromo-7-methoxy-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(CN2C(=O)c3c(OC)cccc3C2Br)cc1 |
| InChI | InChI=1S/C17H16BrNO3/c1-21-12-8-6-11(7-9-12)10-19-16(18)13-4-3-5-14(22-2)15(13)17(19)20/h3-9,16H,10H2,1-2H3 |
| InChIKey | JFBPKRYYJWROGD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|