C14H14BrNO2 — CID 10614726
(1R,4R,7R)-7-bromo-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]hept-5-en-3-one (PubChem CID 10614726) has the molecular formula C14H14BrNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is (1R,4R,7R)-7-bromo-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]hept-5-en-3-one.
| Compound Name | (1R,4R,7R)-7-bromo-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]hept-5-en-3-one |
|---|---|
| PubChem CID | 10614726 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (1R,4R,7R)-7-bromo-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]hept-5-en-3-one |
| SMILES | COc1ccc(CN2C(=O)[C@H]3C=C[C@@H]2[C@@H]3Br)cc1 |
| InChI | InChI=1S/C14H14BrNO2/c1-18-10-4-2-9(3-5-10)8-16-12-7-6-11(13(12)15)14(16)17/h2-7,11-13H,8H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | SXULYEMARHKKHH-YNEHKIRRSA-N |
| XLogP | 2.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|