C14H15BrFNO2 — CID 10568253
(1S,4R,6S,7R)-6-bromo-7-fluoro-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]heptan-3-one (PubChem CID 10568253) has the molecular formula C14H15BrFNO2 and a molecular weight of 328.18 g/mol. Its IUPAC name is (1S,4R,6S,7R)-6-bromo-7-fluoro-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4R,6S,7R)-6-bromo-7-fluoro-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 10568253 |
| Molecular Formula | C14H15BrFNO2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (1S,4R,6S,7R)-6-bromo-7-fluoro-2-[(4-methoxyphenyl)methyl]-2-azabicyclo[2.2.1]heptan-3-one |
| SMILES | COc1ccc(CN2C(=O)[C@H]3C[C@H](Br)[C@@H]2[C@@H]3F)cc1 |
| InChI | InChI=1S/C14H15BrFNO2/c1-19-9-4-2-8(3-5-9)7-17-13-11(15)6-10(12(13)16)14(17)18/h2-5,10-13H,6-7H2,1H3/t10-,11-,12+,13+/m0/s1 |
| InChIKey | ZESBNMLWBUUYJJ-WUHRBBMRSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|