C18H25N2O3+ — CID 7911380
[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[(4-methoxyphenyl)methyl]-methylazanium (PubChem CID 7911380) has the molecular formula C18H25N2O3+ and a molecular weight of 317.41 g/mol. Its IUPAC name is [(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[(4-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[(4-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 7911380 |
| Molecular Formula | C18H25N2O3+ |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | [(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[(4-methoxyphenyl)methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)CN2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-19(11-13-7-9-14(23-2)10-8-13)12-20-17(21)15-5-3-4-6-16(15)18(20)22/h7-10,15-16H,3-6,11-12H2,1-2H3/p+1/t15-,16+ |
| InChIKey | HZQJJLFDORJZJK-IYBDPMFKSA-O |
| XLogP | 0.84 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|