C20H26N3O4+ — CID 9281758
(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-cyclopropyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 9281758) has the molecular formula C20H26N3O4+ and a molecular weight of 372.45 g/mol. Its IUPAC name is (3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-cyclopropyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | (3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-cyclopropyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9281758 |
| Molecular Formula | C20H26N3O4+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)methyl-cyclopropyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH+](CN2C(=O)C(=O)N(C3CCCC3)C2=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-27-17-10-6-14(7-11-17)12-21(15-8-9-15)13-22-18(24)19(25)23(20(22)26)16-4-2-3-5-16/h6-7,10-11,15-16H,2-5,8-9,12-13H2,1H3/p+1 |
| InChIKey | NFWWTUBGPIVJKT-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|