C16H17ClN2O4 — CID 2663052
1-[2-(4-chlorophenoxy)ethyl]-3-cyclopentylimidazolidine-2,4,5-trione (PubChem CID 2663052) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-cyclopentylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-cyclopentylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 2663052 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-cyclopentylimidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O4/c17-11-5-7-13(8-6-11)23-10-9-18-14(20)15(21)19(16(18)22)12-3-1-2-4-12/h5-8,12H,1-4,9-10H2 |
| InChIKey | VBJUVWHFGTVTFW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|