C16H16Cl2N2O4 — CID 7756232
1-cyclopentyl-3-[2-(2,4-dichlorophenoxy)ethyl]imidazolidine-2,4,5-trione (PubChem CID 7756232) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(2,4-dichlorophenoxy)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[2-(2,4-dichlorophenoxy)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7756232 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 1-cyclopentyl-3-[2-(2,4-dichlorophenoxy)ethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O4/c17-10-5-6-13(12(18)9-10)24-8-7-19-14(21)15(22)20(16(19)23)11-3-1-2-4-11/h5-6,9,11H,1-4,7-8H2 |
| InChIKey | UAFXRDQJGWVMMQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|