C16H15BrClNO3 — CID 17464485
2-[2-(2-bromo-4-chlorophenoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 17464485) has the molecular formula C16H15BrClNO3 and a molecular weight of 384.66 g/mol. Its IUPAC name is 2-[2-(2-bromo-4-chlorophenoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[2-(2-bromo-4-chlorophenoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 17464485 |
| Molecular Formula | C16H15BrClNO3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-[2-(2-bromo-4-chlorophenoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1CCOc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C16H15BrClNO3/c17-13-9-10(18)5-6-14(13)22-8-7-19-15(20)11-3-1-2-4-12(11)16(19)21/h1-2,5-6,9,11-12H,3-4,7-8H2 |
| InChIKey | MCGFOHCBNITMDS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|