C15H11Cl2NO4S — CID 2417315
2-[2-(2,4-dichlorophenoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 2417315) has the molecular formula C15H11Cl2NO4S and a molecular weight of 372.23 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 2417315 |
| Molecular Formula | C15H11Cl2NO4S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO4S/c16-10-5-6-13(12(17)9-10)22-8-7-18-15(19)11-3-1-2-4-14(11)23(18,20)21/h1-6,9H,7-8H2 |
| InChIKey | MKTGQRXXFIUOET-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |