C19H15Cl2NO4S — CID 31564124
(2R)-1-(2,4-dichlorophenoxy)-3-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)propan-2-ol (PubChem CID 31564124) has the molecular formula C19H15Cl2NO4S and a molecular weight of 424.31 g/mol. Its IUPAC name is (2R)-1-(2,4-dichlorophenoxy)-3-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)propan-2-ol.
| Compound Name | (2R)-1-(2,4-dichlorophenoxy)-3-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 31564124 |
| Molecular Formula | C19H15Cl2NO4S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2R)-1-(2,4-dichlorophenoxy)-3-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)propan-2-ol |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1C[C@@H](O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2NO4S/c20-13-7-8-17(15(21)9-13)26-11-14(23)10-22-16-5-1-3-12-4-2-6-18(19(12)16)27(22,24)25/h1-9,14,23H,10-11H2/t14-/m1/s1 |
| InChIKey | QUNRENVRLSSSFF-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |