C13H14Cl2N2O4 — CID 39972535
3-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione (PubChem CID 39972535) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is 3-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39972535 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 3-[(2R)-3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(C[C@@H](O)COc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-16-6-12(19)17(13(16)20)5-9(18)7-21-11-3-2-8(14)4-10(11)15/h2-4,9,18H,5-7H2,1H3/t9-/m1/s1 |
| InChIKey | ASGUMWURDDBOSS-SECBINFHSA-N |
| XLogP | 1.63 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|