C14H19Cl2NO3 — CID 110888294
1-(2,4-dichlorophenoxy)-3-(3-methylmorpholin-4-yl)propan-2-ol (PubChem CID 110888294) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)-3-(3-methylmorpholin-4-yl)propan-2-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)-3-(3-methylmorpholin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 110888294 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)-3-(3-methylmorpholin-4-yl)propan-2-ol |
| SMILES | CC1COCCN1CC(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO3/c1-10-8-19-5-4-17(10)7-12(18)9-20-14-3-2-11(15)6-13(14)16/h2-3,6,10,12,18H,4-5,7-9H2,1H3 |
| InChIKey | ANWFJKVJIWKMJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |