C18H14ClNO3S — CID 18090962
3-[(5-chloro-2-methoxyphenyl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 18090962) has the molecular formula C18H14ClNO3S and a molecular weight of 359.83 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 18090962 |
| Molecular Formula | C18H14ClNO3S |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | COc1ccc(Cl)cc1CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C18H14ClNO3S/c1-23-16-9-8-14(19)10-13(16)11-20-15-6-2-4-12-5-3-7-17(18(12)15)24(20,21)22/h2-10H,11H2,1H3 |
| InChIKey | XZIIITNJHKSTGU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |