C22H18N2O4S2 — CID 78789813
3-[[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 78789813) has the molecular formula C22H18N2O4S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 78789813 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 3-[[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | COc1ccc(-c2nc(CN3c4cccc5cccc(c45)S3(=O)=O)cs2)c(OC)c1 |
| InChI | InChI=1S/C22H18N2O4S2/c1-27-16-9-10-17(19(11-16)28-2)22-23-15(13-29-22)12-24-18-7-3-5-14-6-4-8-20(21(14)18)30(24,25)26/h3-11,13H,12H2,1-2H3 |
| InChIKey | OMJWYHVCXPGLSF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |