C17H20N2O2S3 — CID 34967643
[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate (PubChem CID 34967643) has the molecular formula C17H20N2O2S3 and a molecular weight of 380.56 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 34967643 |
| Molecular Formula | C17H20N2O2S3 |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(-c2nc(CSC(=S)N3CCCC3)cs2)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O2S3/c1-20-13-5-6-14(15(9-13)21-2)16-18-12(10-23-16)11-24-17(22)19-7-3-4-8-19/h5-6,9-10H,3-4,7-8,11H2,1-2H3 |
| InChIKey | YNLXDWULCVJKCZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|