C16H18N2OS3 — CID 78765679
[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate (PubChem CID 78765679) has the molecular formula C16H18N2OS3 and a molecular weight of 350.53 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate.
| Compound Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 78765679 |
| Molecular Formula | C16H18N2OS3 |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(-c2nc(CSC(=S)N3CCCC3)cs2)cc1 |
| InChI | InChI=1S/C16H18N2OS3/c1-19-14-6-4-12(5-7-14)15-17-13(10-21-15)11-22-16(20)18-8-2-3-9-18/h4-7,10H,2-3,8-9,11H2,1H3 |
| InChIKey | LQBHUNRBVCHUAD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|