C20H25N3OS3 — CID 7605648
[2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate (PubChem CID 7605648) has the molecular formula C20H25N3OS3 and a molecular weight of 419.64 g/mol. Its IUPAC name is [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate.
| Compound Name | [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7605648 |
| Molecular Formula | C20H25N3OS3 |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2-(N-acetyl-2,4,6-trimethylanilino)-1,3-thiazol-4-yl]methyl pyrrolidine-1-carbodithioate |
| SMILES | CC(=O)N(c1nc(CSC(=S)N2CCCC2)cs1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H25N3OS3/c1-13-9-14(2)18(15(3)10-13)23(16(4)24)19-21-17(11-26-19)12-27-20(25)22-7-5-6-8-22/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | AGNUKAQCZMQQED-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|