C17H19N3O2S3 — CID 7605698
[2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7605698) has the molecular formula C17H19N3O2S3 and a molecular weight of 393.56 g/mol. Its IUPAC name is [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7605698 |
| Molecular Formula | C17H19N3O2S3 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [2-[[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(-c2csc(NC(=O)CSC(=S)N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C17H19N3O2S3/c1-22-13-6-4-12(5-7-13)14-10-24-16(18-14)19-15(21)11-25-17(23)20-8-2-3-9-20/h4-7,10H,2-3,8-9,11H2,1H3,(H,18,19,21) |
| InChIKey | RHMQQVDRXJEWTA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|