C18H21N3OS3 — CID 27666282
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 27666282) has the molecular formula C18H21N3OS3 and a molecular weight of 391.59 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 27666282 |
| Molecular Formula | C18H21N3OS3 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | CC1CCN(C(=S)SCC(=O)Nc2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C18H21N3OS3/c1-13-7-9-21(10-8-13)18(23)25-12-16(22)20-17-19-15(11-24-17)14-5-3-2-4-6-14/h2-6,11,13H,7-10,12H2,1H3,(H,19,20,22) |
| InChIKey | LBCWDNDJOIBAST-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|