C20H18N2O2S2 — CID 16949174
S-[2-[[4-(4-benzylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] ethanethioate (PubChem CID 16949174) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is S-[2-[[4-(4-benzylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[4-(4-benzylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 16949174 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | S-[2-[[4-(4-benzylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)Nc1nc(-c2ccc(Cc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C20H18N2O2S2/c1-14(23)25-13-19(24)22-20-21-18(12-26-20)17-9-7-16(8-10-17)11-15-5-3-2-4-6-15/h2-10,12H,11,13H2,1H3,(H,21,22,24) |
| InChIKey | XYUMXKPSHQHBOG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|