C25H22N2OS — CID 43951129
N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)acetamide (PubChem CID 43951129) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43951129 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[4-(4-benzylphenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2nc(-c3ccc(Cc4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c1-18-7-9-21(10-8-18)16-24(28)27-25-26-23(17-29-25)22-13-11-20(12-14-22)15-19-5-3-2-4-6-19/h2-14,17H,15-16H2,1H3,(H,26,27,28) |
| InChIKey | VEOVDZVMMJAYOU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |