C22H23N3O2S — CID 55487125
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-[(2-phenylacetyl)amino]propanamide (PubChem CID 55487125) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-[(2-phenylacetyl)amino]propanamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 55487125 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-[(2-phenylacetyl)amino]propanamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)CCNC(=O)Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-2-16-8-10-18(11-9-16)19-15-28-22(24-19)25-20(26)12-13-23-21(27)14-17-6-4-3-5-7-17/h3-11,15H,2,12-14H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | SSPJUGYRZKVHMT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |