C20H18N2O3S — CID 43951125
methyl 4-[2-[[2-(4-methylphenyl)acetyl]amino]-1,3-thiazol-4-yl]benzoate (PubChem CID 43951125) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is methyl 4-[2-[[2-(4-methylphenyl)acetyl]amino]-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-[[2-(4-methylphenyl)acetyl]amino]-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 43951125 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | methyl 4-[2-[[2-(4-methylphenyl)acetyl]amino]-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(NC(=O)Cc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-13-3-5-14(6-4-13)11-18(23)22-20-21-17(12-26-20)15-7-9-16(10-8-15)19(24)25-2/h3-10,12H,11H2,1-2H3,(H,21,22,23) |
| InChIKey | JFGHNTPWRCWVJF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |