C12H13ClN4OS2 — CID 171150561
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] carbamimidothioate;hydrochloride (PubChem CID 171150561) has the molecular formula C12H13ClN4OS2 and a molecular weight of 328.85 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] carbamimidothioate;hydrochloride.
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 171150561 |
| Molecular Formula | C12H13ClN4OS2 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCC(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H12N4OS2.ClH/c13-11(14)18-7-10(17)16-12-15-9(6-19-12)8-4-2-1-3-5-8;/h1-6H,7H2,(H3,13,14)(H,15,16,17);1H |
| InChIKey | VEMBTMYBUOGPMA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|