C19H23N3O2S3 — CID 9483978
[2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] piperidine-1-carbodithioate (PubChem CID 9483978) has the molecular formula C19H23N3O2S3 and a molecular weight of 421.61 g/mol. Its IUPAC name is [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] piperidine-1-carbodithioate.
| Compound Name | [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 9483978 |
| Molecular Formula | C19H23N3O2S3 |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [2-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] piperidine-1-carbodithioate |
| SMILES | CCOc1ccc(-c2csc(NC(=O)CSC(=S)N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H23N3O2S3/c1-2-24-15-8-6-14(7-9-15)16-12-26-18(20-16)21-17(23)13-27-19(25)22-10-4-3-5-11-22/h6-9,12H,2-5,10-11,13H2,1H3,(H,20,21,23) |
| InChIKey | KIRHBJRGBBGBNV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|