C18H23N4OS3+ — CID 9457635
[2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate (PubChem CID 9457635) has the molecular formula C18H23N4OS3+ and a molecular weight of 407.61 g/mol. Its IUPAC name is [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate.
| Compound Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
|---|---|
| PubChem CID | 9457635 |
| Molecular Formula | C18H23N4OS3+ |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSC(=S)N3CC[NH+](C)CC3)n2)cc1 |
| InChI | InChI=1S/C18H22N4OS3/c1-13-3-5-14(6-4-13)15-11-25-17(19-15)20-16(23)12-26-18(24)22-9-7-21(2)8-10-22/h3-6,11H,7-10,12H2,1-2H3,(H,19,20,23)/p+1 |
| InChIKey | RAGMDOZJKZFVFB-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|