C16H21N5OS2 — CID 71653121
[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methyl piperazine-1-carbodithioate (PubChem CID 71653121) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is [1-[(4-methoxyphenyl)methyl]triazol-4-yl]methyl piperazine-1-carbodithioate.
| Compound Name | [1-[(4-methoxyphenyl)methyl]triazol-4-yl]methyl piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 71653121 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [1-[(4-methoxyphenyl)methyl]triazol-4-yl]methyl piperazine-1-carbodithioate |
| SMILES | COc1ccc(Cn2cc(CSC(=S)N3CCNCC3)nn2)cc1 |
| InChI | InChI=1S/C16H21N5OS2/c1-22-15-4-2-13(3-5-15)10-21-11-14(18-19-21)12-24-16(23)20-8-6-17-7-9-20/h2-5,11,17H,6-10,12H2,1H3 |
| InChIKey | DNONSJSRJGVOOV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|