C20H26N6O4S2 — CID 72713320
tert-butyl 4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate (PubChem CID 72713320) has the molecular formula C20H26N6O4S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is tert-butyl 4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 72713320 |
| Molecular Formula | C20H26N6O4S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | tert-butyl 4-[[1-[(4-nitrophenyl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=S)SCc2cn(Cc3ccc([N+](=O)[O-])cc3)nn2)CC1 |
| InChI | InChI=1S/C20H26N6O4S2/c1-20(2,3)30-18(27)23-8-10-24(11-9-23)19(31)32-14-16-13-25(22-21-16)12-15-4-6-17(7-5-15)26(28)29/h4-7,13H,8-12,14H2,1-3H3 |
| InChIKey | GGBZPLIZQMVNJS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|