C23H28N6O4S2 — CID 73055334
tert-butyl 4-[[1-[(7-amino-2-oxochromen-4-yl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate (PubChem CID 73055334) has the molecular formula C23H28N6O4S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is tert-butyl 4-[[1-[(7-amino-2-oxochromen-4-yl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-[(7-amino-2-oxochromen-4-yl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 73055334 |
| Molecular Formula | C23H28N6O4S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | tert-butyl 4-[[1-[(7-amino-2-oxochromen-4-yl)methyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=S)SCc2cn(Cc3cc(=O)oc4cc(N)ccc34)nn2)CC1 |
| InChI | InChI=1S/C23H28N6O4S2/c1-23(2,3)33-21(31)27-6-8-28(9-7-27)22(34)35-14-17-13-29(26-25-17)12-15-10-20(30)32-19-11-16(24)4-5-18(15)19/h4-5,10-11,13H,6-9,12,14,24H2,1-3H3 |
| InChIKey | UNKSOEFNLIWIHH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|