C20H24F3N5O2S2 — CID 71653426
tert-butyl 4-[[1-[3-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate (PubChem CID 71653426) has the molecular formula C20H24F3N5O2S2 and a molecular weight of 487.57 g/mol. Its IUPAC name is tert-butyl 4-[[1-[3-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-[3-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71653426 |
| Molecular Formula | C20H24F3N5O2S2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | tert-butyl 4-[[1-[3-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=S)SCc2cn(-c3cccc(C(F)(F)F)c3)nn2)CC1 |
| InChI | InChI=1S/C20H24F3N5O2S2/c1-19(2,3)30-17(29)26-7-9-27(10-8-26)18(31)32-13-15-12-28(25-24-15)16-6-4-5-14(11-16)20(21,22)23/h4-6,11-12H,7-10,13H2,1-3H3 |
| InChIKey | FUPJKFSSVZSWRN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|