C21H27N7O2S2 — CID 72713540
tert-butyl 4-[[1-(1H-benzimidazol-2-ylmethyl)triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate (PubChem CID 72713540) has the molecular formula C21H27N7O2S2 and a molecular weight of 473.63 g/mol. Its IUPAC name is tert-butyl 4-[[1-(1H-benzimidazol-2-ylmethyl)triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(1H-benzimidazol-2-ylmethyl)triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 72713540 |
| Molecular Formula | C21H27N7O2S2 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | tert-butyl 4-[[1-(1H-benzimidazol-2-ylmethyl)triazol-4-yl]methylsulfanylcarbothioyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=S)SCc2cn(Cc3nc4ccccc4[nH]3)nn2)CC1 |
| InChI | InChI=1S/C21H27N7O2S2/c1-21(2,3)30-19(29)26-8-10-27(11-9-26)20(31)32-14-15-12-28(25-24-15)13-18-22-16-6-4-5-7-17(16)23-18/h4-7,12H,8-11,13-14H2,1-3H3,(H,22,23) |
| InChIKey | QLNCQBUXYHMXNH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|