C19H14F3NO3S — CID 94866799
(1R)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-1-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 94866799) has the molecular formula C19H14F3NO3S and a molecular weight of 393.39 g/mol. Its IUPAC name is (1R)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-1-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1R)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-1-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 94866799 |
| Molecular Formula | C19H14F3NO3S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (1R)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-1-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1C[C@H](O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO3S/c20-19(21,22)14-8-2-1-7-13(14)16(24)11-23-15-9-3-5-12-6-4-10-17(18(12)15)27(23,25)26/h1-10,16,24H,11H2/t16-/m0/s1 |
| InChIKey | RXLGZRFOAFKFNR-INIZCTEOSA-N |
| XLogP | 4.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |