C15H11Cl2F3O — CID 63411008
2-(2,6-dichlorophenyl)-1-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 63411008) has the molecular formula C15H11Cl2F3O and a molecular weight of 335.15 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-[2-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-[2-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 63411008 |
| Molecular Formula | C15H11Cl2F3O |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H11Cl2F3O/c16-12-6-3-7-13(17)10(12)8-14(21)9-4-1-2-5-11(9)15(18,19)20/h1-7,14,21H,8H2 |
| InChIKey | DOLDDGWBRPFGPX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |