C20H18FNO4S — CID 31564175
(2S)-1-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-3-[(2-fluorophenyl)methoxy]propan-2-ol (PubChem CID 31564175) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is (2S)-1-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-3-[(2-fluorophenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-3-[(2-fluorophenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 31564175 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (2S)-1-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-3-[(2-fluorophenyl)methoxy]propan-2-ol |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1C[C@H](O)COCc1ccccc1F |
| InChI | InChI=1S/C20H18FNO4S/c21-17-8-2-1-5-15(17)12-26-13-16(23)11-22-18-9-3-6-14-7-4-10-19(20(14)18)27(22,24)25/h1-10,16,23H,11-13H2/t16-/m0/s1 |
| InChIKey | KHKCTJAUXYBXTF-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |