C23H28N3O4+ — CID 9244393
(4-tert-butylphenyl)methyl-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-methylazanium (PubChem CID 9244393) has the molecular formula C23H28N3O4+ and a molecular weight of 410.49 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-methylazanium.
| Compound Name | (4-tert-butylphenyl)methyl-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9244393 |
| Molecular Formula | C23H28N3O4+ |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]-methylazanium |
| SMILES | COc1ccc(N2C(=O)C(=O)N(C[NH+](C)Cc3ccc(C(C)(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-23(2,3)17-8-6-16(7-9-17)14-24(4)15-25-20(27)21(28)26(22(25)29)18-10-12-19(30-5)13-11-18/h6-13H,14-15H2,1-5H3/p+1 |
| InChIKey | VFJNZFRKKPXFLD-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|