C19H18N2O5 — CID 8597515
1-(4-methoxyphenyl)-3-[2-(2-methylphenoxy)ethyl]imidazolidine-2,4,5-trione (PubChem CID 8597515) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-(2-methylphenoxy)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-(2-methylphenoxy)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8597515 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-(2-methylphenoxy)ethyl]imidazolidine-2,4,5-trione |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CCOc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O5/c1-13-5-3-4-6-16(13)26-12-11-20-17(22)18(23)21(19(20)24)14-7-9-15(25-2)10-8-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | XHQUJKFHQQNASK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|