C22H28N3O3+ — CID 9169331
benzyl-[[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-methylazanium (PubChem CID 9169331) has the molecular formula C22H28N3O3+ and a molecular weight of 382.48 g/mol. Its IUPAC name is benzyl-[[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-methylazanium.
| Compound Name | benzyl-[[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9169331 |
| Molecular Formula | C22H28N3O3+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | benzyl-[[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-methylazanium |
| SMILES | COc1ccc(CC[C@]2(C)NC(=O)N(C[NH+](C)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(14-13-17-9-11-19(28-3)12-10-17)20(26)25(21(27)23-22)16-24(2)15-18-7-5-4-6-8-18/h4-12H,13-16H2,1-3H3,(H,23,27)/p+1/t22-/m0/s1 |
| InChIKey | UQTBNQIRDKUPDX-QFIPXVFZSA-O |
| XLogP | 1.61 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|