C21H24N2O3 — CID 8507004
(5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 8507004) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8507004 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CC[C@@]2(C)NC(=O)N(Cc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-6-4-5-7-17(15)14-23-19(24)21(2,22-20(23)25)13-12-16-8-10-18(26-3)11-9-16/h4-11H,12-14H2,1-3H3,(H,22,25)/t21-/m1/s1 |
| InChIKey | LZKLMJCUSLMIGZ-OAQYLSRUSA-N |
| XLogP | 3.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|