C21H25ClN3O2+ — CID 7480340
(3-chlorophenyl)methyl-methyl-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]methyl]azanium (PubChem CID 7480340) has the molecular formula C21H25ClN3O2+ and a molecular weight of 386.90 g/mol. Its IUPAC name is (3-chlorophenyl)methyl-methyl-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]methyl]azanium.
| Compound Name | (3-chlorophenyl)methyl-methyl-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 7480340 |
| Molecular Formula | C21H25ClN3O2+ |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3-chlorophenyl)methyl-methyl-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]methyl]azanium |
| SMILES | C[NH+](Cc1cccc(Cl)c1)CN1C(=O)N[C@](C)(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C21H24ClN3O2/c1-21(12-11-16-7-4-3-5-8-16)19(26)25(20(27)23-21)15-24(2)14-17-9-6-10-18(22)13-17/h3-10,13H,11-12,14-15H2,1-2H3,(H,23,27)/p+1/t21-/m1/s1 |
| InChIKey | DXQNHJCRHCFYTJ-OAQYLSRUSA-O |
| XLogP | 2.26 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|