C17H24N3O3+ — CID 7479984
(5S)-5-methyl-3-(morpholin-4-ium-4-ylmethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 7479984) has the molecular formula C17H24N3O3+ and a molecular weight of 318.40 g/mol. Its IUPAC name is (5S)-5-methyl-3-(morpholin-4-ium-4-ylmethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-3-(morpholin-4-ium-4-ylmethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7479984 |
| Molecular Formula | C17H24N3O3+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (5S)-5-methyl-3-(morpholin-4-ium-4-ylmethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(C[NH+]2CCOCC2)C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-17(8-7-14-5-3-2-4-6-14)15(21)20(16(22)18-17)13-19-9-11-23-12-10-19/h2-6H,7-13H2,1H3,(H,18,22)/p+1/t17-/m0/s1 |
| InChIKey | JGFFIRYLYJYZEF-KRWDZBQOSA-O |
| XLogP | -0.20 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|