About 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione
5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 2672005) has the molecular formula C22H26N3O3+
and a molecular weight of 380.47 g/mol. Its IUPAC name is 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione |
| PubChem CID | 2672005 |
| Molecular Formula | C22H26N3O3+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)(Cc2ccccc2)C(=O)N1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H25N3O3/c26-20-22(15-18-7-3-1-4-8-18,16-19-9-5-2-6-10-19)23-21(27)25(20)17-24-11-13-28-14-12-24/h1-10H,11-17H2,(H,23,27)/p+1 |
| InChIKey | UMEGAPLCWCSBDO-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione?
The IUPAC name of 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione (CID 2672005) is 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione is O=C1NC(Cc2ccccc2)(Cc2ccccc2)C(=O)N1C[NH+]1CCOCC1.
What is the InChIKey of 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione?
The InChIKey is UMEGAPLCWCSBDO-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H25N3O3/c26-20-22(15-18-7-3-1-4-8-18,16-19-9-5-2-6-10-19)23-21(27)25(20)17-24-11-13-28-14-12-24/h1-10H,11-17H2,(H,23,27)/p+1.
What are the key properties of 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione?
5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione has a molecular weight of 380.47 g/mol, XLogP of 0.63, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibenzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 2672005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).