C29H27N3O4 — CID 17399817
5,5-dibenzyl-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 17399817) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17399817 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 5,5-dibenzyl-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)NC(Cc2ccccc2)(Cc2ccccc2)C1=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C29H27N3O4/c33-25(23-13-7-14-24(17-23)31-16-8-15-26(31)34)20-32-27(35)29(30-28(32)36,18-21-9-3-1-4-10-21)19-22-11-5-2-6-12-22/h1-7,9-14,17H,8,15-16,18-20H2,(H,30,36) |
| InChIKey | GLPUFQHGAUBXOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|