C19H17FN2O3 — CID 110409978
N-[2-(4-fluorophenyl)-2-oxoethyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 110409978) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-oxoethyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-oxoethyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 110409978 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-oxoethyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(N2CCCC2=O)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O3/c20-15-8-6-13(7-9-15)17(23)12-21-19(25)14-3-1-4-16(11-14)22-10-2-5-18(22)24/h1,3-4,6-9,11H,2,5,10,12H2,(H,21,25) |
| InChIKey | LPNPROICIIMWBM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |