C15H18N3O4+ — CID 7911108
1-benzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 7911108) has the molecular formula C15H18N3O4+ and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-benzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-benzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7911108 |
| Molecular Formula | C15H18N3O4+ |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-benzyl-3-(morpholin-4-ium-4-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C[NH+]2CCOCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H17N3O4/c19-13-14(20)18(11-16-6-8-22-9-7-16)15(21)17(13)10-12-4-2-1-3-5-12/h1-5H,6-11H2/p+1 |
| InChIKey | OLUKSISPLOLBOO-UHFFFAOYSA-O |
| XLogP | -1.15 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|