C17H30N3O+3 — CID 7436889
4-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]morpholin-4-ium (PubChem CID 7436889) has the molecular formula C17H30N3O+3 and a molecular weight of 292.45 g/mol. Its IUPAC name is 4-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]morpholin-4-ium.
| Compound Name | 4-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7436889 |
| Molecular Formula | C17H30N3O+3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4-[2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl]morpholin-4-ium |
| SMILES | c1ccc(C[NH+]2CC[NH+](CC[NH+]3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C17H27N3O/c1-2-4-17(5-3-1)16-20-10-8-18(9-11-20)6-7-19-12-14-21-15-13-19/h1-5H,6-16H2/p+3 |
| InChIKey | CHQFISWZZSUTGI-UHFFFAOYSA-Q |
| XLogP | -3.11 |
| TPSA | 22.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |