C20H36N2O4+2 — CID 7064770
7-benzyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane (PubChem CID 7064770) has the molecular formula C20H36N2O4+2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 7-benzyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane.
| Compound Name | 7-benzyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane |
|---|---|
| PubChem CID | 7064770 |
| Molecular Formula | C20H36N2O4+2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 7-benzyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane |
| SMILES | C[NH+]1CCOCCOCC[NH+](Cc2ccccc2)CCOCCOCC1 |
| InChI | InChI=1S/C20H34N2O4/c1-21-7-11-23-15-17-25-13-9-22(19-20-5-3-2-4-6-20)10-14-26-18-16-24-12-8-21/h2-6H,7-19H2,1H3/p+2 |
| InChIKey | ORJWVUHAKDKQLZ-UHFFFAOYSA-P |
| XLogP | -1.33 |
| TPSA | 45.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |