C13H20NO3+ — CID 6942878
4-[(3,5-dimethoxyphenyl)methyl]morpholin-4-ium (PubChem CID 6942878) has the molecular formula C13H20NO3+ and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-[(3,5-dimethoxyphenyl)methyl]morpholin-4-ium.
| Compound Name | 4-[(3,5-dimethoxyphenyl)methyl]morpholin-4-ium |
|---|---|
| PubChem CID | 6942878 |
| Molecular Formula | C13H20NO3+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-[(3,5-dimethoxyphenyl)methyl]morpholin-4-ium |
| SMILES | COc1cc(C[NH+]2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C13H19NO3/c1-15-12-7-11(8-13(9-12)16-2)10-14-3-5-17-6-4-14/h7-9H,3-6,10H2,1-2H3/p+1 |
| InChIKey | YYLXOWZSJJBNRZ-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |