C20H25N2O3+ — CID 135818085
4-methoxy-2-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyliminomethyl]phenol (PubChem CID 135818085) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-methoxy-2-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyliminomethyl]phenol.
| Compound Name | 4-methoxy-2-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 135818085 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-methoxy-2-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyliminomethyl]phenol |
| SMILES | COc1ccc(O)c(/C=N/Cc2ccc(C[NH+]3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-19-6-7-20(23)18(12-19)14-21-13-16-2-4-17(5-3-16)15-22-8-10-25-11-9-22/h2-7,12,14,23H,8-11,13,15H2,1H3/p+1/b21-14+ |
| InChIKey | YKOZNFCGCPYBSO-KGENOOAVSA-O |
| XLogP | 1.43 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|